C16H18FIN4O4 — CID 67523092
4-(2-fluoro-4-iodoanilino)-N-(3-hydroxypropyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide (PubChem CID 67523092) has the molecular formula C16H18FIN4O4 and a molecular weight of 476.25 g/mol. Its IUPAC name is 4-(2-fluoro-4-iodoanilino)-N-(3-hydroxypropyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide.
| Compound Name | 4-(2-fluoro-4-iodoanilino)-N-(3-hydroxypropyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 67523092 |
| Molecular Formula | C16H18FIN4O4 |
| Molecular Weight | 476.25 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 4-(2-fluoro-4-iodoanilino)-N-(3-hydroxypropyl)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide |
| SMILES | Cn1c(Nc2ccc(I)cc2F)c(C(=O)NCCCO)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H18FIN4O4/c1-21-13(20-11-5-4-9(18)8-10(11)17)12(14(24)19-6-3-7-23)15(25)22(2)16(21)26/h4-5,8,20,23H,3,6-7H2,1-2H3,(H,19,24) |
| InChIKey | SCXPKMOALSGXOA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|