C17H17FIN3O3 — CID 169436317
N-cyclopropyl-2-(2-fluoro-4-iodoanilino)-4-hydroxy-1,5-dimethyl-6-oxopyridine-3-carboxamide (PubChem CID 169436317) has the molecular formula C17H17FIN3O3 and a molecular weight of 457.24 g/mol. Its IUPAC name is N-cyclopropyl-2-(2-fluoro-4-iodoanilino)-4-hydroxy-1,5-dimethyl-6-oxopyridine-3-carboxamide.
| Compound Name | N-cyclopropyl-2-(2-fluoro-4-iodoanilino)-4-hydroxy-1,5-dimethyl-6-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 169436317 |
| Molecular Formula | C17H17FIN3O3 |
| Molecular Weight | 457.24 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | N-cyclopropyl-2-(2-fluoro-4-iodoanilino)-4-hydroxy-1,5-dimethyl-6-oxopyridine-3-carboxamide |
| SMILES | Cc1c(O)c(C(=O)NC2CC2)c(Nc2ccc(I)cc2F)n(C)c1=O |
| InChI | InChI=1S/C17H17FIN3O3/c1-8-14(23)13(16(24)20-10-4-5-10)15(22(2)17(8)25)21-12-6-3-9(19)7-11(12)18/h3,6-7,10,21,23H,4-5H2,1-2H3,(H,20,24) |
| InChIKey | FGZABESIXPRNLG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|