C27H35FN4O3S — CID 170602166
4-(3-aminophenoxy)-N-cyclopropyl-2-(2-fluoro-4-methylanilino)-1,5-dimethyl-6-oxopyridine-3-carboxamide;ethane;methanethiol (PubChem CID 170602166) has the molecular formula C27H35FN4O3S and a molecular weight of 514.67 g/mol. Its IUPAC name is 4-(3-aminophenoxy)-N-cyclopropyl-2-(2-fluoro-4-methylanilino)-1,5-dimethyl-6-oxopyridine-3-carboxamide;ethane;methanethiol.
| Compound Name | 4-(3-aminophenoxy)-N-cyclopropyl-2-(2-fluoro-4-methylanilino)-1,5-dimethyl-6-oxopyridine-3-carboxamide;ethane;methanethiol |
|---|---|
| PubChem CID | 170602166 |
| Molecular Formula | C27H35FN4O3S |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | 4-(3-aminophenoxy)-N-cyclopropyl-2-(2-fluoro-4-methylanilino)-1,5-dimethyl-6-oxopyridine-3-carboxamide;ethane;methanethiol |
| SMILES | CC.CS.Cc1ccc(Nc2c(C(=O)NC3CC3)c(Oc3cccc(N)c3)c(C)c(=O)n2C)c(F)c1 |
| InChI | InChI=1S/C24H25FN4O3.C2H6.CH4S/c1-13-7-10-19(18(25)11-13)28-22-20(23(30)27-16-8-9-16)21(14(2)24(31)29(22)3)32-17-6-4-5-15(26)12-17;2*1-2/h4-7,10-12,16,28H,8-9,26H2,1-3H3,(H,27,30);1-2H3;2H,1H3 |
| InChIKey | WEPJHEDBCODCJR-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|