C17H20FIN4O6 — CID 25108961
N-[(3S)-3,4-dihydroxybutoxy]-4-(2-fluoro-4-iodoanilino)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide (PubChem CID 25108961) has the molecular formula C17H20FIN4O6 and a molecular weight of 522.27 g/mol. Its IUPAC name is N-[(3S)-3,4-dihydroxybutoxy]-4-(2-fluoro-4-iodoanilino)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide.
| Compound Name | N-[(3S)-3,4-dihydroxybutoxy]-4-(2-fluoro-4-iodoanilino)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 25108961 |
| Molecular Formula | C17H20FIN4O6 |
| Molecular Weight | 522.27 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | N-[(3S)-3,4-dihydroxybutoxy]-4-(2-fluoro-4-iodoanilino)-1,3-dimethyl-2,6-dioxopyrimidine-5-carboxamide |
| SMILES | Cn1c(Nc2ccc(I)cc2F)c(C(=O)NOCC[C@H](O)CO)c(=O)n(C)c1=O |
| InChI | InChI=1S/C17H20FIN4O6/c1-22-14(20-12-4-3-9(19)7-11(12)18)13(16(27)23(2)17(22)28)15(26)21-29-6-5-10(25)8-24/h3-4,7,10,20,24-25H,5-6,8H2,1-2H3,(H,21,26)/t10-/m0/s1 |
| InChIKey | QBKMTEWQCPSMFN-JTQLQIEISA-N |
| XLogP | -0.02 |
| TPSA | 134.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.27 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|