C20H23FIN3O5 — CID 25124822
N-[(2R)-2,4-dihydroxybutoxy]-2-(2-fluoro-4-iodoanilino)-1-methyl-7-oxo-5,6-dihydro-4H-indole-3-carboxamide (PubChem CID 25124822) has the molecular formula C20H23FIN3O5 and a molecular weight of 531.32 g/mol. Its IUPAC name is N-[(2R)-2,4-dihydroxybutoxy]-2-(2-fluoro-4-iodoanilino)-1-methyl-7-oxo-5,6-dihydro-4H-indole-3-carboxamide.
| Compound Name | N-[(2R)-2,4-dihydroxybutoxy]-2-(2-fluoro-4-iodoanilino)-1-methyl-7-oxo-5,6-dihydro-4H-indole-3-carboxamide |
|---|---|
| PubChem CID | 25124822 |
| Molecular Formula | C20H23FIN3O5 |
| Molecular Weight | 531.32 g/mol |
| Exact Mass | 531.07 |
| IUPAC Name | N-[(2R)-2,4-dihydroxybutoxy]-2-(2-fluoro-4-iodoanilino)-1-methyl-7-oxo-5,6-dihydro-4H-indole-3-carboxamide |
| SMILES | Cn1c(Nc2ccc(I)cc2F)c(C(=O)NOC[C@H](O)CCO)c2c1C(=O)CCC2 |
| InChI | InChI=1S/C20H23FIN3O5/c1-25-18-13(3-2-4-16(18)28)17(20(29)24-30-10-12(27)7-8-26)19(25)23-15-6-5-11(22)9-14(15)21/h5-6,9,12,23,26-27H,2-4,7-8,10H2,1H3,(H,24,29)/t12-/m1/s1 |
| InChIKey | HNNRRNZAJVOXQZ-GFCCVEGCSA-N |
| XLogP | 2.44 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|