C19H17FIN3O4S — CID 86671098
N-(2-ethenoxyethoxy)-6-(2-fluoro-4-iodoanilino)-5-methyl-4-oxothieno[3,2-c]pyridine-7-carboxamide (PubChem CID 86671098) has the molecular formula C19H17FIN3O4S and a molecular weight of 529.33 g/mol. Its IUPAC name is N-(2-ethenoxyethoxy)-6-(2-fluoro-4-iodoanilino)-5-methyl-4-oxothieno[3,2-c]pyridine-7-carboxamide.
| Compound Name | N-(2-ethenoxyethoxy)-6-(2-fluoro-4-iodoanilino)-5-methyl-4-oxothieno[3,2-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 86671098 |
| Molecular Formula | C19H17FIN3O4S |
| Molecular Weight | 529.33 g/mol |
| Exact Mass | 529.00 |
| IUPAC Name | N-(2-ethenoxyethoxy)-6-(2-fluoro-4-iodoanilino)-5-methyl-4-oxothieno[3,2-c]pyridine-7-carboxamide |
| SMILES | C=COCCONC(=O)c1c(Nc2ccc(I)cc2F)n(C)c(=O)c2ccsc12 |
| InChI | InChI=1S/C19H17FIN3O4S/c1-3-27-7-8-28-23-18(25)15-16-12(6-9-29-16)19(26)24(2)17(15)22-14-5-4-11(21)10-13(14)20/h3-6,9-10,22H,1,7-8H2,2H3,(H,23,25) |
| InChIKey | TUPAXQMLHVWOOM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|