C18H17ClIN5O3S — CID 126592568
6-(2-chloro-4-iodoanilino)-5-methyl-N-(3-nitrosopropyl)-4-oxothieno[3,2-c]pyridine-7-carbohydrazide (PubChem CID 126592568) has the molecular formula C18H17ClIN5O3S and a molecular weight of 545.79 g/mol. Its IUPAC name is 6-(2-chloro-4-iodoanilino)-5-methyl-N-(3-nitrosopropyl)-4-oxothieno[3,2-c]pyridine-7-carbohydrazide.
| Compound Name | 6-(2-chloro-4-iodoanilino)-5-methyl-N-(3-nitrosopropyl)-4-oxothieno[3,2-c]pyridine-7-carbohydrazide |
|---|---|
| PubChem CID | 126592568 |
| Molecular Formula | C18H17ClIN5O3S |
| Molecular Weight | 545.79 g/mol |
| Exact Mass | 544.98 |
| IUPAC Name | 6-(2-chloro-4-iodoanilino)-5-methyl-N-(3-nitrosopropyl)-4-oxothieno[3,2-c]pyridine-7-carbohydrazide |
| SMILES | Cn1c(Nc2ccc(I)cc2Cl)c(C(=O)N(N)CCCN=O)c2sccc2c1=O |
| InChI | InChI=1S/C18H17ClIN5O3S/c1-24-16(23-13-4-3-10(20)9-12(13)19)14(15-11(17(24)26)5-8-29-15)18(27)25(21)7-2-6-22-28/h3-5,8-9,23H,2,6-7,21H2,1H3 |
| InChIKey | RLUJZKFDKOBEGX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 109.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.79 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|