C19H19ClIN3O3S — CID 53357967
6-(2-chloro-4-iodoanilino)-N-(3-hydroxypropyl)-3,5-dimethyl-4-oxothieno[3,2-c]pyridine-7-carboxamide (PubChem CID 53357967) has the molecular formula C19H19ClIN3O3S and a molecular weight of 531.80 g/mol. Its IUPAC name is 6-(2-chloro-4-iodoanilino)-N-(3-hydroxypropyl)-3,5-dimethyl-4-oxothieno[3,2-c]pyridine-7-carboxamide.
| Compound Name | 6-(2-chloro-4-iodoanilino)-N-(3-hydroxypropyl)-3,5-dimethyl-4-oxothieno[3,2-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 53357967 |
| Molecular Formula | C19H19ClIN3O3S |
| Molecular Weight | 531.80 g/mol |
| Exact Mass | 530.99 |
| IUPAC Name | 6-(2-chloro-4-iodoanilino)-N-(3-hydroxypropyl)-3,5-dimethyl-4-oxothieno[3,2-c]pyridine-7-carboxamide |
| SMILES | Cc1csc2c(C(=O)NCCCO)c(Nc3ccc(I)cc3Cl)n(C)c(=O)c12 |
| InChI | InChI=1S/C19H19ClIN3O3S/c1-10-9-28-16-14(10)19(27)24(2)17(15(16)18(26)22-6-3-7-25)23-13-5-4-11(21)8-12(13)20/h4-5,8-9,23,25H,3,6-7H2,1-2H3,(H,22,26) |
| InChIKey | QAWIGSAAMXKTMI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.80 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|