C17H16ClIN4O4 — CID 67065976
5-(2-chloro-4-iodoanilino)-3-(2,3-dihydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 67065976) has the molecular formula C17H16ClIN4O4 and a molecular weight of 502.70 g/mol. Its IUPAC name is 5-(2-chloro-4-iodoanilino)-3-(2,3-dihydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-(2-chloro-4-iodoanilino)-3-(2,3-dihydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 67065976 |
| Molecular Formula | C17H16ClIN4O4 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 501.99 |
| IUPAC Name | 5-(2-chloro-4-iodoanilino)-3-(2,3-dihydroxypropyl)-8-methylpyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | Cn1c(=O)cc(Nc2ccc(I)cc2Cl)c2c(=O)n(CC(O)CO)cnc21 |
| InChI | InChI=1S/C17H16ClIN4O4/c1-22-14(26)5-13(21-12-3-2-9(19)4-11(12)18)15-16(22)20-8-23(17(15)27)6-10(25)7-24/h2-5,8,10,21,24-25H,6-7H2,1H3 |
| InChIKey | DXUVSLXDCYKLIP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|