C14H14ClIN2O2 — CID 107606838
N-(2-chloro-4-iodophenyl)-1-(2-methoxyethyl)pyrrole-2-carboxamide (PubChem CID 107606838) has the molecular formula C14H14ClIN2O2 and a molecular weight of 404.64 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-1-(2-methoxyethyl)pyrrole-2-carboxamide.
| Compound Name | N-(2-chloro-4-iodophenyl)-1-(2-methoxyethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107606838 |
| Molecular Formula | C14H14ClIN2O2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-1-(2-methoxyethyl)pyrrole-2-carboxamide |
| SMILES | COCCn1cccc1C(=O)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C14H14ClIN2O2/c1-20-8-7-18-6-2-3-13(18)14(19)17-12-5-4-10(16)9-11(12)15/h2-6,9H,7-8H2,1H3,(H,17,19) |
| InChIKey | ULSIMGTVYVWTIL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|