C12H13ClN4O2 — CID 107595875
N-(5-chloropyrazin-2-yl)-1-(2-methoxyethyl)pyrrole-2-carboxamide (PubChem CID 107595875) has the molecular formula C12H13ClN4O2 and a molecular weight of 280.72 g/mol. Its IUPAC name is N-(5-chloropyrazin-2-yl)-1-(2-methoxyethyl)pyrrole-2-carboxamide.
| Compound Name | N-(5-chloropyrazin-2-yl)-1-(2-methoxyethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107595875 |
| Molecular Formula | C12H13ClN4O2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N-(5-chloropyrazin-2-yl)-1-(2-methoxyethyl)pyrrole-2-carboxamide |
| SMILES | COCCn1cccc1C(=O)Nc1cnc(Cl)cn1 |
| InChI | InChI=1S/C12H13ClN4O2/c1-19-6-5-17-4-2-3-9(17)12(18)16-11-8-14-10(13)7-15-11/h2-4,7-8H,5-6H2,1H3,(H,15,16,18) |
| InChIKey | CGYZKHYWOBRIJX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |