C13H14BrN3O2 — CID 114609182
N-(6-bromo-2-pyridinyl)-1-(2-methoxyethyl)pyrrole-2-carboxamide (PubChem CID 114609182) has the molecular formula C13H14BrN3O2 and a molecular weight of 324.18 g/mol. Its IUPAC name is N-(6-bromo-2-pyridinyl)-1-(2-methoxyethyl)pyrrole-2-carboxamide.
| Compound Name | N-(6-bromo-2-pyridinyl)-1-(2-methoxyethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114609182 |
| Molecular Formula | C13H14BrN3O2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | N-(6-bromo-2-pyridinyl)-1-(2-methoxyethyl)pyrrole-2-carboxamide |
| SMILES | COCCn1cccc1C(=O)Nc1cccc(Br)n1 |
| InChI | InChI=1S/C13H14BrN3O2/c1-19-9-8-17-7-3-4-10(17)13(18)16-12-6-2-5-11(14)15-12/h2-7H,8-9H2,1H3,(H,15,16,18) |
| InChIKey | TYFYOJUMUFLUBK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|