C12H16N2O4 — CID 114608926
1-[[1-(2-methoxyethyl)pyrrole-2-carbonyl]amino]cyclopropane-1-carboxylic acid (PubChem CID 114608926) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 1-[[1-(2-methoxyethyl)pyrrole-2-carbonyl]amino]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[1-(2-methoxyethyl)pyrrole-2-carbonyl]amino]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 114608926 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 1-[[1-(2-methoxyethyl)pyrrole-2-carbonyl]amino]cyclopropane-1-carboxylic acid |
| SMILES | COCCn1cccc1C(=O)NC1(C(=O)O)CC1 |
| InChI | InChI=1S/C12H16N2O4/c1-18-8-7-14-6-2-3-9(14)10(15)13-12(4-5-12)11(16)17/h2-3,6H,4-5,7-8H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | TZBOZQFTSXBREN-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |