C14H22N2O4 — CID 114609728
N-[(4-hydroxyoxan-4-yl)methyl]-1-(2-methoxyethyl)pyrrole-2-carboxamide (PubChem CID 114609728) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is N-[(4-hydroxyoxan-4-yl)methyl]-1-(2-methoxyethyl)pyrrole-2-carboxamide.
| Compound Name | N-[(4-hydroxyoxan-4-yl)methyl]-1-(2-methoxyethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 114609728 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-[(4-hydroxyoxan-4-yl)methyl]-1-(2-methoxyethyl)pyrrole-2-carboxamide |
| SMILES | COCCn1cccc1C(=O)NCC1(O)CCOCC1 |
| InChI | InChI=1S/C14H22N2O4/c1-19-10-7-16-6-2-3-12(16)13(17)15-11-14(18)4-8-20-9-5-14/h2-3,6,18H,4-5,7-11H2,1H3,(H,15,17) |
| InChIKey | HRGCIHOHTBIWDW-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |