C11H16N2O5 — CID 114608626
3-hydroxy-2-[[1-(2-methoxyethyl)pyrrole-2-carbonyl]amino]propanoic acid (PubChem CID 114608626) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is 3-hydroxy-2-[[1-(2-methoxyethyl)pyrrole-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[[1-(2-methoxyethyl)pyrrole-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 114608626 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 3-hydroxy-2-[[1-(2-methoxyethyl)pyrrole-2-carbonyl]amino]propanoic acid |
| SMILES | COCCn1cccc1C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C11H16N2O5/c1-18-6-5-13-4-2-3-9(13)10(15)12-8(7-14)11(16)17/h2-4,8,14H,5-7H2,1H3,(H,12,15)(H,16,17) |
| InChIKey | WZNSEOHNCNSIIF-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |