C13H10ClIN2O3 — CID 107605953
1-[2-(2-chloro-4-iodoanilino)-2-oxoethyl]pyrrole-2-carboxylic acid (PubChem CID 107605953) has the molecular formula C13H10ClIN2O3 and a molecular weight of 404.59 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-iodoanilino)-2-oxoethyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[2-(2-chloro-4-iodoanilino)-2-oxoethyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 107605953 |
| Molecular Formula | C13H10ClIN2O3 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 403.94 |
| IUPAC Name | 1-[2-(2-chloro-4-iodoanilino)-2-oxoethyl]pyrrole-2-carboxylic acid |
| SMILES | O=C(Cn1cccc1C(=O)O)Nc1ccc(I)cc1Cl |
| InChI | InChI=1S/C13H10ClIN2O3/c14-9-6-8(15)3-4-10(9)16-12(18)7-17-5-1-2-11(17)13(19)20/h1-6H,7H2,(H,16,18)(H,19,20) |
| InChIKey | GSOJXNAGMPODMN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|