C13H10Cl2N2O3 — CID 79325609
1-[2-(3,5-dichloroanilino)-2-oxoethyl]pyrrole-2-carboxylic acid (PubChem CID 79325609) has the molecular formula C13H10Cl2N2O3 and a molecular weight of 313.14 g/mol. Its IUPAC name is 1-[2-(3,5-dichloroanilino)-2-oxoethyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[2-(3,5-dichloroanilino)-2-oxoethyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 79325609 |
| Molecular Formula | C13H10Cl2N2O3 |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 1-[2-(3,5-dichloroanilino)-2-oxoethyl]pyrrole-2-carboxylic acid |
| SMILES | O=C(Cn1cccc1C(=O)O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H10Cl2N2O3/c14-8-4-9(15)6-10(5-8)16-12(18)7-17-3-1-2-11(17)13(19)20/h1-6H,7H2,(H,16,18)(H,19,20) |
| InChIKey | BZZKSVIUAYNARG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |