C20H19ClN2O2 — CID 86876655
N-(2-chloro-4-methoxyphenyl)-1-(2-phenylethyl)pyrrole-2-carboxamide (PubChem CID 86876655) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is N-(2-chloro-4-methoxyphenyl)-1-(2-phenylethyl)pyrrole-2-carboxamide.
| Compound Name | N-(2-chloro-4-methoxyphenyl)-1-(2-phenylethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 86876655 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-(2-chloro-4-methoxyphenyl)-1-(2-phenylethyl)pyrrole-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cccn2CCc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C20H19ClN2O2/c1-25-16-9-10-18(17(21)14-16)22-20(24)19-8-5-12-23(19)13-11-15-6-3-2-4-7-15/h2-10,12,14H,11,13H2,1H3,(H,22,24) |
| InChIKey | APUZJKSVAZIYCO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |