C18H17FIN3O5 — CID 86712551
6-(2-fluoro-4-iodoanilino)-N-(2-methoxyethoxy)-5-methyl-4-oxofuro[3,2-c]pyridine-7-carboxamide (PubChem CID 86712551) has the molecular formula C18H17FIN3O5 and a molecular weight of 501.25 g/mol. Its IUPAC name is 6-(2-fluoro-4-iodoanilino)-N-(2-methoxyethoxy)-5-methyl-4-oxofuro[3,2-c]pyridine-7-carboxamide.
| Compound Name | 6-(2-fluoro-4-iodoanilino)-N-(2-methoxyethoxy)-5-methyl-4-oxofuro[3,2-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 86712551 |
| Molecular Formula | C18H17FIN3O5 |
| Molecular Weight | 501.25 g/mol |
| Exact Mass | 501.02 |
| IUPAC Name | 6-(2-fluoro-4-iodoanilino)-N-(2-methoxyethoxy)-5-methyl-4-oxofuro[3,2-c]pyridine-7-carboxamide |
| SMILES | COCCONC(=O)c1c(Nc2ccc(I)cc2F)n(C)c(=O)c2ccoc12 |
| InChI | InChI=1S/C18H17FIN3O5/c1-23-16(21-13-4-3-10(20)9-12(13)19)14(17(24)22-28-8-7-26-2)15-11(18(23)25)5-6-27-15/h3-6,9,21H,7-8H2,1-2H3,(H,22,24) |
| InChIKey | KDRXRFUAYCXIGO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|