C19H21FIN3O5 — CID 126592353
6-(2-fluoro-4-iodoanilino)-7-[hydroxy-[(1-hydroxy-2-methylpropan-2-yl)oxyamino]methyl]-5-methylfuro[3,2-c]pyridin-4-one (PubChem CID 126592353) has the molecular formula C19H21FIN3O5 and a molecular weight of 517.30 g/mol. Its IUPAC name is 6-(2-fluoro-4-iodoanilino)-7-[hydroxy-[(1-hydroxy-2-methylpropan-2-yl)oxyamino]methyl]-5-methylfuro[3,2-c]pyridin-4-one.
| Compound Name | 6-(2-fluoro-4-iodoanilino)-7-[hydroxy-[(1-hydroxy-2-methylpropan-2-yl)oxyamino]methyl]-5-methylfuro[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 126592353 |
| Molecular Formula | C19H21FIN3O5 |
| Molecular Weight | 517.30 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 6-(2-fluoro-4-iodoanilino)-7-[hydroxy-[(1-hydroxy-2-methylpropan-2-yl)oxyamino]methyl]-5-methylfuro[3,2-c]pyridin-4-one |
| SMILES | Cn1c(Nc2ccc(I)cc2F)c(C(O)NOC(C)(C)CO)c2occc2c1=O |
| InChI | InChI=1S/C19H21FIN3O5/c1-19(2,9-25)29-23-17(26)14-15-11(6-7-28-15)18(27)24(3)16(14)22-13-5-4-10(21)8-12(13)20/h4-8,17,22-23,25-26H,9H2,1-3H3 |
| InChIKey | CDYILLBBEWOVLV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|