C16H16FIN4O4S — CID 126592379
6-(2-fluoro-4-iodoanilino)-7-[hydroxy-(2-hydroxyethoxyamino)methyl]-5-methyl-[1,3]thiazolo[4,5-c]pyridin-4-one (PubChem CID 126592379) has the molecular formula C16H16FIN4O4S and a molecular weight of 506.30 g/mol. Its IUPAC name is 6-(2-fluoro-4-iodoanilino)-7-[hydroxy-(2-hydroxyethoxyamino)methyl]-5-methyl-[1,3]thiazolo[4,5-c]pyridin-4-one.
| Compound Name | 6-(2-fluoro-4-iodoanilino)-7-[hydroxy-(2-hydroxyethoxyamino)methyl]-5-methyl-[1,3]thiazolo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 126592379 |
| Molecular Formula | C16H16FIN4O4S |
| Molecular Weight | 506.30 g/mol |
| Exact Mass | 505.99 |
| IUPAC Name | 6-(2-fluoro-4-iodoanilino)-7-[hydroxy-(2-hydroxyethoxyamino)methyl]-5-methyl-[1,3]thiazolo[4,5-c]pyridin-4-one |
| SMILES | Cn1c(Nc2ccc(I)cc2F)c(C(O)NOCCO)c2scnc2c1=O |
| InChI | InChI=1S/C16H16FIN4O4S/c1-22-14(20-10-3-2-8(18)6-9(10)17)11(15(24)21-26-5-4-23)13-12(16(22)25)19-7-27-13/h2-3,6-7,15,20-21,23-24H,4-5H2,1H3 |
| InChIKey | TUBYGNYMARTULE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|