C16H14F2IN3O3S — CID 163448677
2-[[[5-fluoro-2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]-hydroxymethyl]amino]oxyethanol (PubChem CID 163448677) has the molecular formula C16H14F2IN3O3S and a molecular weight of 493.27 g/mol. Its IUPAC name is 2-[[[5-fluoro-2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]-hydroxymethyl]amino]oxyethanol.
| Compound Name | 2-[[[5-fluoro-2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]-hydroxymethyl]amino]oxyethanol |
|---|---|
| PubChem CID | 163448677 |
| Molecular Formula | C16H14F2IN3O3S |
| Molecular Weight | 493.27 g/mol |
| Exact Mass | 492.98 |
| IUPAC Name | 2-[[[5-fluoro-2-(2-fluoro-4-iodoanilino)thieno[2,3-b]pyridin-3-yl]-hydroxymethyl]amino]oxyethanol |
| SMILES | OCCONC(O)c1c(Nc2ccc(I)cc2F)sc2ncc(F)cc12 |
| InChI | InChI=1S/C16H14F2IN3O3S/c17-8-5-10-13(14(24)22-25-4-3-23)16(26-15(10)20-7-8)21-12-2-1-9(19)6-11(12)18/h1-2,5-7,14,21-24H,3-4H2 |
| InChIKey | BESGMCZIISRIOJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 86.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.27 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|