C15H13FIN5O3 — CID 44603081
4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1H-pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 44603081) has the molecular formula C15H13FIN5O3 and a molecular weight of 457.20 g/mol. Its IUPAC name is 4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1H-pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | 4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1H-pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 44603081 |
| Molecular Formula | C15H13FIN5O3 |
| Molecular Weight | 457.20 g/mol |
| Exact Mass | 457.00 |
| IUPAC Name | 4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1H-pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | O=C(NOCCO)c1cnc2[nH]ncc2c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C15H13FIN5O3/c16-11-5-8(17)1-2-12(11)20-13-9-7-19-21-14(9)18-6-10(13)15(24)22-25-4-3-23/h1-2,5-7,23H,3-4H2,(H,22,24)(H2,18,19,20,21) |
| InChIKey | JKZGFJXSSQZDOU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|