C15H12F3IN2O3 — CID 10114957
4,5-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide (PubChem CID 10114957) has the molecular formula C15H12F3IN2O3 and a molecular weight of 452.17 g/mol. Its IUPAC name is 4,5-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 4,5-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 10114957 |
| Molecular Formula | C15H12F3IN2O3 |
| Molecular Weight | 452.17 g/mol |
| Exact Mass | 451.98 |
| IUPAC Name | 4,5-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide |
| SMILES | O=C(NOCCO)c1cc(F)c(F)cc1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C15H12F3IN2O3/c16-10-6-9(15(23)21-24-4-3-22)14(7-11(10)17)20-13-2-1-8(19)5-12(13)18/h1-2,5-7,20,22H,3-4H2,(H,21,23) |
| InChIKey | NZLBVPZBNGBXPI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.17 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|