C19H19F2IN4O5 — CID 11444193
4-fluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-[2-(methylamino)-2-oxoethoxy]iminomethyl]benzamide (PubChem CID 11444193) has the molecular formula C19H19F2IN4O5 and a molecular weight of 548.28 g/mol. Its IUPAC name is 4-fluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-[2-(methylamino)-2-oxoethoxy]iminomethyl]benzamide.
| Compound Name | 4-fluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-[2-(methylamino)-2-oxoethoxy]iminomethyl]benzamide |
|---|---|
| PubChem CID | 11444193 |
| Molecular Formula | C19H19F2IN4O5 |
| Molecular Weight | 548.28 g/mol |
| Exact Mass | 548.04 |
| IUPAC Name | 4-fluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-[2-(methylamino)-2-oxoethoxy]iminomethyl]benzamide |
| SMILES | CNC(=O)CO/N=C/c1cc(C(=O)NOCCO)c(Nc2ccc(I)cc2F)cc1F |
| InChI | InChI=1S/C19H19F2IN4O5/c1-23-18(28)10-31-24-9-11-6-13(19(29)26-30-5-4-27)17(8-14(11)20)25-16-3-2-12(22)7-15(16)21/h2-3,6-9,25,27H,4-5,10H2,1H3,(H,23,28)(H,26,29)/b24-9+ |
| InChIKey | LKRUBNYBXCURTA-PGGKNCGUSA-N |
| XLogP | 2.06 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|