C19H18F3IN4O5 — CID 172962885
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-2-methoxyiminoethoxyiminomethyl]benzamide (PubChem CID 172962885) has the molecular formula C19H18F3IN4O5 and a molecular weight of 566.27 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-2-methoxyiminoethoxyiminomethyl]benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-2-methoxyiminoethoxyiminomethyl]benzamide |
|---|---|
| PubChem CID | 172962885 |
| Molecular Formula | C19H18F3IN4O5 |
| Molecular Weight | 566.27 g/mol |
| Exact Mass | 566.03 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-2-methoxyiminoethoxyiminomethyl]benzamide |
| SMILES | CON=CCO/N=C/c1cc(C(=O)NOCCO)c(Nc2ccc(I)cc2F)c(F)c1F |
| InChI | InChI=1S/C19H18F3IN4O5/c1-30-24-4-6-31-25-10-11-8-13(19(29)27-32-7-5-28)18(17(22)16(11)21)26-15-3-2-12(23)9-14(15)20/h2-4,8-10,26,28H,5-7H2,1H3,(H,27,29)/b24-4?,25-10+ |
| InChIKey | GNYZCVKHISQDKJ-GGPMMILUSA-N |
| XLogP | 3.09 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|