C18H16F3IN4O5 — CID 72818126
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(2-hydroxyiminoethoxyiminomethyl)benzamide (PubChem CID 72818126) has the molecular formula C18H16F3IN4O5 and a molecular weight of 552.25 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(2-hydroxyiminoethoxyiminomethyl)benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(2-hydroxyiminoethoxyiminomethyl)benzamide |
|---|---|
| PubChem CID | 72818126 |
| Molecular Formula | C18H16F3IN4O5 |
| Molecular Weight | 552.25 g/mol |
| Exact Mass | 552.01 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(2-hydroxyiminoethoxyiminomethyl)benzamide |
| SMILES | O=C(NOCCO)c1cc(C=NOCC=NO)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C18H16F3IN4O5/c19-13-8-11(22)1-2-14(13)25-17-12(18(28)26-31-6-4-27)7-10(15(20)16(17)21)9-24-30-5-3-23-29/h1-3,7-9,25,27,29H,4-6H2,(H,26,28) |
| InChIKey | YOUZVZHGLWKLHR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 124.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|