C19H19F3IN3O5 — CID 85426389
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(3-hydroxypropoxyiminomethyl)benzamide (PubChem CID 85426389) has the molecular formula C19H19F3IN3O5 and a molecular weight of 553.28 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(3-hydroxypropoxyiminomethyl)benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(3-hydroxypropoxyiminomethyl)benzamide |
|---|---|
| PubChem CID | 85426389 |
| Molecular Formula | C19H19F3IN3O5 |
| Molecular Weight | 553.28 g/mol |
| Exact Mass | 553.03 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-(3-hydroxypropoxyiminomethyl)benzamide |
| SMILES | O=C(NOCCO)c1cc(C=NOCCCO)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C19H19F3IN3O5/c20-14-9-12(23)2-3-15(14)25-18-13(19(29)26-31-7-5-28)8-11(16(21)17(18)22)10-24-30-6-1-4-27/h2-3,8-10,25,27-28H,1,4-7H2,(H,26,29) |
| InChIKey | DMGKVJHIYNSOFI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|