C21H22F3IN4O5 — CID 23132369
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-[4-(methylamino)-4-oxobutoxy]iminomethyl]benzamide (PubChem CID 23132369) has the molecular formula C21H22F3IN4O5 and a molecular weight of 594.33 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-[4-(methylamino)-4-oxobutoxy]iminomethyl]benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-[4-(methylamino)-4-oxobutoxy]iminomethyl]benzamide |
|---|---|
| PubChem CID | 23132369 |
| Molecular Formula | C21H22F3IN4O5 |
| Molecular Weight | 594.33 g/mol |
| Exact Mass | 594.06 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(E)-[4-(methylamino)-4-oxobutoxy]iminomethyl]benzamide |
| SMILES | CNC(=O)CCCO/N=C/c1cc(C(=O)NOCCO)c(Nc2ccc(I)cc2F)c(F)c1F |
| InChI | InChI=1S/C21H22F3IN4O5/c1-26-17(31)3-2-7-33-27-11-12-9-14(21(32)29-34-8-6-30)20(19(24)18(12)23)28-16-5-4-13(25)10-15(16)22/h4-5,9-11,28,30H,2-3,6-8H2,1H3,(H,26,31)(H,29,32)/b27-11+ |
| InChIKey | QBIYDNSPPHLUTH-LUOAPIJWSA-N |
| XLogP | 2.98 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|