C20H21F3IN3O5 — CID 11273055
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[2-(2-hydroxyethoxy)ethyliminomethyl]benzamide (PubChem CID 11273055) has the molecular formula C20H21F3IN3O5 and a molecular weight of 567.30 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[2-(2-hydroxyethoxy)ethyliminomethyl]benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[2-(2-hydroxyethoxy)ethyliminomethyl]benzamide |
|---|---|
| PubChem CID | 11273055 |
| Molecular Formula | C20H21F3IN3O5 |
| Molecular Weight | 567.30 g/mol |
| Exact Mass | 567.05 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[2-(2-hydroxyethoxy)ethyliminomethyl]benzamide |
| SMILES | O=C(NOCCO)c1cc(/C=N/CCOCCO)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C20H21F3IN3O5/c21-15-10-13(24)1-2-16(15)26-19-14(20(30)27-32-8-5-29)9-12(17(22)18(19)23)11-25-3-6-31-7-4-28/h1-2,9-11,26,28-29H,3-8H2,(H,27,30)/b25-11+ |
| InChIKey | ZLKVMEREICXHEM-OPEKNORGSA-N |
| XLogP | 2.53 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|