C22H25F3IN3O5 — CID 72804192
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(3-methoxy-3-methylbutoxy)iminomethyl]benzamide (PubChem CID 72804192) has the molecular formula C22H25F3IN3O5 and a molecular weight of 595.36 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(3-methoxy-3-methylbutoxy)iminomethyl]benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(3-methoxy-3-methylbutoxy)iminomethyl]benzamide |
|---|---|
| PubChem CID | 72804192 |
| Molecular Formula | C22H25F3IN3O5 |
| Molecular Weight | 595.36 g/mol |
| Exact Mass | 595.08 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(3-methoxy-3-methylbutoxy)iminomethyl]benzamide |
| SMILES | COC(C)(C)CCON=Cc1cc(C(=O)NOCCO)c(Nc2ccc(I)cc2F)c(F)c1F |
| InChI | InChI=1S/C22H25F3IN3O5/c1-22(2,32-3)6-8-33-27-12-13-10-15(21(31)29-34-9-7-30)20(19(25)18(13)24)28-17-5-4-14(26)11-16(17)23/h4-5,10-12,28,30H,6-9H2,1-3H3,(H,29,31) |
| InChIKey | AGPKGFZDFFWTEW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|