C16H13F3IN3O4 — CID 85418493
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-hydroxy-5-(2-hydroxyethoxyiminomethyl)benzamide (PubChem CID 85418493) has the molecular formula C16H13F3IN3O4 and a molecular weight of 495.20 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-hydroxy-5-(2-hydroxyethoxyiminomethyl)benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-hydroxy-5-(2-hydroxyethoxyiminomethyl)benzamide |
|---|---|
| PubChem CID | 85418493 |
| Molecular Formula | C16H13F3IN3O4 |
| Molecular Weight | 495.20 g/mol |
| Exact Mass | 494.99 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-hydroxy-5-(2-hydroxyethoxyiminomethyl)benzamide |
| SMILES | O=C(NO)c1cc(C=NOCCO)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C16H13F3IN3O4/c17-11-6-9(20)1-2-12(11)22-15-10(16(25)23-26)5-8(13(18)14(15)19)7-21-27-4-3-24/h1-2,5-7,22,24,26H,3-4H2,(H,23,25) |
| InChIKey | TTZCCNCXKZZEPX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.20 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|