C22H24F3IN4O5 — CID 11410906
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[(E)-2-hydroxyethoxyiminomethyl]-N-(2-morpholin-4-ylethoxy)benzamide (PubChem CID 11410906) has the molecular formula C22H24F3IN4O5 and a molecular weight of 608.36 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[(E)-2-hydroxyethoxyiminomethyl]-N-(2-morpholin-4-ylethoxy)benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[(E)-2-hydroxyethoxyiminomethyl]-N-(2-morpholin-4-ylethoxy)benzamide |
|---|---|
| PubChem CID | 11410906 |
| Molecular Formula | C22H24F3IN4O5 |
| Molecular Weight | 608.36 g/mol |
| Exact Mass | 608.07 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-5-[(E)-2-hydroxyethoxyiminomethyl]-N-(2-morpholin-4-ylethoxy)benzamide |
| SMILES | O=C(NOCCN1CCOCC1)c1cc(/C=N/OCCO)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C22H24F3IN4O5/c23-17-12-15(26)1-2-18(17)28-21-16(11-14(19(24)20(21)25)13-27-34-10-6-31)22(32)29-35-9-5-30-3-7-33-8-4-30/h1-2,11-13,28,31H,3-10H2,(H,29,32)/b27-13+ |
| InChIKey | OYAUPYJWGBORLX-UVHMKAGCSA-N |
| XLogP | 2.79 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|