C24H28F3IN4O6 — CID 91181689
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[1-(2-hydroxyethoxyamino)-3-morpholin-4-ylprop-1-enyl]benzamide (PubChem CID 91181689) has the molecular formula C24H28F3IN4O6 and a molecular weight of 652.41 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[1-(2-hydroxyethoxyamino)-3-morpholin-4-ylprop-1-enyl]benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[1-(2-hydroxyethoxyamino)-3-morpholin-4-ylprop-1-enyl]benzamide |
|---|---|
| PubChem CID | 91181689 |
| Molecular Formula | C24H28F3IN4O6 |
| Molecular Weight | 652.41 g/mol |
| Exact Mass | 652.10 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[1-(2-hydroxyethoxyamino)-3-morpholin-4-ylprop-1-enyl]benzamide |
| SMILES | O=C(NOCCO)c1cc(C(=CCN2CCOCC2)NOCCO)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C24H28F3IN4O6/c25-18-13-15(28)1-2-20(18)29-23-17(24(35)31-38-12-8-34)14-16(21(26)22(23)27)19(30-37-11-7-33)3-4-32-5-9-36-10-6-32/h1-3,13-14,29-30,33-34H,4-12H2,(H,31,35) |
| InChIKey | QZVKUYCPBLEZOE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|