C20H23F3IN3O5 — CID 11519788
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[2-(2-hydroxyethylamino)ethoxymethyl]benzamide (PubChem CID 11519788) has the molecular formula C20H23F3IN3O5 and a molecular weight of 569.32 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[2-(2-hydroxyethylamino)ethoxymethyl]benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[2-(2-hydroxyethylamino)ethoxymethyl]benzamide |
|---|---|
| PubChem CID | 11519788 |
| Molecular Formula | C20H23F3IN3O5 |
| Molecular Weight | 569.32 g/mol |
| Exact Mass | 569.06 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[2-(2-hydroxyethylamino)ethoxymethyl]benzamide |
| SMILES | O=C(NOCCO)c1cc(COCCNCCO)c(F)c(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C20H23F3IN3O5/c21-15-10-13(24)1-2-16(15)26-19-14(20(30)27-32-8-6-29)9-12(17(22)18(19)23)11-31-7-4-25-3-5-28/h1-2,9-10,25-26,28-29H,3-8,11H2,(H,27,30) |
| InChIKey | PGOOHETXQGEOCQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 112.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|