C20H22F3IN4O5 — CID 87260064
5-[[ethylcarbamoyl(methoxy)amino]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide (PubChem CID 87260064) has the molecular formula C20H22F3IN4O5 and a molecular weight of 582.32 g/mol. Its IUPAC name is 5-[[ethylcarbamoyl(methoxy)amino]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 5-[[ethylcarbamoyl(methoxy)amino]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 87260064 |
| Molecular Formula | C20H22F3IN4O5 |
| Molecular Weight | 582.32 g/mol |
| Exact Mass | 582.06 |
| IUPAC Name | 5-[[ethylcarbamoyl(methoxy)amino]methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide |
| SMILES | CCNC(=O)N(Cc1cc(C(=O)NOCCO)c(Nc2ccc(I)cc2F)c(F)c1F)OC |
| InChI | InChI=1S/C20H22F3IN4O5/c1-3-25-20(31)28(32-2)10-11-8-13(19(30)27-33-7-6-29)18(17(23)16(11)22)26-15-5-4-12(24)9-14(15)21/h4-5,8-9,26,29H,3,6-7,10H2,1-2H3,(H,25,31)(H,27,30) |
| InChIKey | SULQWCZTBFPIAQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|