C21H21F3IN3O5 — CID 11592297
5-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide (PubChem CID 11592297) has the molecular formula C21H21F3IN3O5 and a molecular weight of 579.31 g/mol. Its IUPAC name is 5-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 5-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 11592297 |
| Molecular Formula | C21H21F3IN3O5 |
| Molecular Weight | 579.31 g/mol |
| Exact Mass | 579.05 |
| IUPAC Name | 5-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]-3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)benzamide |
| SMILES | CC1(C)CON(Cc2cc(C(=O)NOCCO)c(Nc3ccc(I)cc3F)c(F)c2F)C1=O |
| InChI | InChI=1S/C21H21F3IN3O5/c1-21(2)10-33-28(20(21)31)9-11-7-13(19(30)27-32-6-5-29)18(17(24)16(11)23)26-15-4-3-12(25)8-14(15)22/h3-4,7-8,26,29H,5-6,9-10H2,1-2H3,(H,27,30) |
| InChIKey | PNKLSORQFNHZSQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|