C20H23F3IN3O4S — CID 11606734
3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(3-methylsulfanylpropoxyamino)methyl]benzamide (PubChem CID 11606734) has the molecular formula C20H23F3IN3O4S and a molecular weight of 585.39 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(3-methylsulfanylpropoxyamino)methyl]benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(3-methylsulfanylpropoxyamino)methyl]benzamide |
|---|---|
| PubChem CID | 11606734 |
| Molecular Formula | C20H23F3IN3O4S |
| Molecular Weight | 585.39 g/mol |
| Exact Mass | 585.04 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-5-[(3-methylsulfanylpropoxyamino)methyl]benzamide |
| SMILES | CSCCCONCc1cc(C(=O)NOCCO)c(Nc2ccc(I)cc2F)c(F)c1F |
| InChI | InChI=1S/C20H23F3IN3O4S/c1-32-8-2-6-30-25-11-12-9-14(20(29)27-31-7-5-28)19(18(23)17(12)22)26-16-4-3-13(24)10-15(16)21/h3-4,9-10,25-26,28H,2,5-8,11H2,1H3,(H,27,29) |
| InChIKey | WBIODLIVLLITOU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|