C18H18F3N3O4 — CID 143173044
3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-(formamidomethyl)-N-(2-hydroxyethoxy)benzamide (PubChem CID 143173044) has the molecular formula C18H18F3N3O4 and a molecular weight of 397.35 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-(formamidomethyl)-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-(formamidomethyl)-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 143173044 |
| Molecular Formula | C18H18F3N3O4 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-(formamidomethyl)-N-(2-hydroxyethoxy)benzamide |
| SMILES | Cc1ccc(Nc2c(C(=O)NOCCO)cc(CNC=O)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C18H18F3N3O4/c1-10-2-3-14(13(19)6-10)23-17-12(18(27)24-28-5-4-25)7-11(8-22-9-26)15(20)16(17)21/h2-3,6-7,9,23,25H,4-5,8H2,1H3,(H,22,26)(H,24,27) |
| InChIKey | QAKAWUNDBZMZBN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|