C25H33F3N4O5 — CID 143173110
3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-[(E)-[3-oxo-3-(propylamino)propoxy]iminomethyl]benzamide;ethane (PubChem CID 143173110) has the molecular formula C25H33F3N4O5 and a molecular weight of 526.56 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-[(E)-[3-oxo-3-(propylamino)propoxy]iminomethyl]benzamide;ethane.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-[(E)-[3-oxo-3-(propylamino)propoxy]iminomethyl]benzamide;ethane |
|---|---|
| PubChem CID | 143173110 |
| Molecular Formula | C25H33F3N4O5 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-[(E)-[3-oxo-3-(propylamino)propoxy]iminomethyl]benzamide;ethane |
| SMILES | CC.CCCNC(=O)CCO/N=C/c1cc(C(=O)NOCCO)c(Nc2ccc(C)cc2F)c(F)c1F |
| InChI | InChI=1S/C23H27F3N4O5.C2H6/c1-3-7-27-19(32)6-9-34-28-13-15-12-16(23(33)30-35-10-8-31)22(21(26)20(15)25)29-18-5-4-14(2)11-17(18)24;1-2/h4-5,11-13,29,31H,3,6-10H2,1-2H3,(H,27,32)(H,30,33);1-2H3/b28-13+; |
| InChIKey | GTHFZHSMQIEOEW-SLSLNKSHSA-N |
| XLogP | 4.10 |
| TPSA | 121.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|