C23H21F3N4O4 — CID 143019243
3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-[(E)-pyridin-4-ylmethoxyiminomethyl]benzamide (PubChem CID 143019243) has the molecular formula C23H21F3N4O4 and a molecular weight of 474.44 g/mol. Its IUPAC name is 3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-[(E)-pyridin-4-ylmethoxyiminomethyl]benzamide.
| Compound Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-[(E)-pyridin-4-ylmethoxyiminomethyl]benzamide |
|---|---|
| PubChem CID | 143019243 |
| Molecular Formula | C23H21F3N4O4 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 3,4-difluoro-2-(2-fluoro-4-methylanilino)-N-(2-hydroxyethoxy)-5-[(E)-pyridin-4-ylmethoxyiminomethyl]benzamide |
| SMILES | Cc1ccc(Nc2c(C(=O)NOCCO)cc(/C=N/OCc3ccncc3)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C23H21F3N4O4/c1-14-2-3-19(18(24)10-14)29-22-17(23(32)30-33-9-8-31)11-16(20(25)21(22)26)12-28-34-13-15-4-6-27-7-5-15/h2-7,10-12,29,31H,8-9,13H2,1H3,(H,30,32)/b28-12+ |
| InChIKey | PIWNHWMXEPNXGJ-KVSWJAHQSA-N |
| XLogP | 3.76 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|