C20H22F3N3O6 — CID 143019240
N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[(E)-2-hydroxyethoxyiminomethyl]benzamide (PubChem CID 143019240) has the molecular formula C20H22F3N3O6 and a molecular weight of 457.41 g/mol. Its IUPAC name is N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[(E)-2-hydroxyethoxyiminomethyl]benzamide.
| Compound Name | N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[(E)-2-hydroxyethoxyiminomethyl]benzamide |
|---|---|
| PubChem CID | 143019240 |
| Molecular Formula | C20H22F3N3O6 |
| Molecular Weight | 457.41 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-(2-fluoro-4-methylanilino)-5-[(E)-2-hydroxyethoxyiminomethyl]benzamide |
| SMILES | Cc1ccc(Nc2c(C(=O)NOCC(O)CO)cc(/C=N/OCCO)c(F)c2F)c(F)c1 |
| InChI | InChI=1S/C20H22F3N3O6/c1-11-2-3-16(15(21)6-11)25-19-14(20(30)26-32-10-13(29)9-28)7-12(17(22)18(19)23)8-24-31-5-4-27/h2-3,6-8,13,25,27-29H,4-5,9-10H2,1H3,(H,26,30)/b24-8+ |
| InChIKey | DQWICSKTVLVAOK-KTZMUZOWSA-N |
| XLogP | 1.51 |
| TPSA | 132.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|