C19H23F3N2O4 — CID 143815087
N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-(2-fluoro-4-methylanilino)benzamide;ethane (PubChem CID 143815087) has the molecular formula C19H23F3N2O4 and a molecular weight of 400.40 g/mol. Its IUPAC name is N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-(2-fluoro-4-methylanilino)benzamide;ethane.
| Compound Name | N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-(2-fluoro-4-methylanilino)benzamide;ethane |
|---|---|
| PubChem CID | 143815087 |
| Molecular Formula | C19H23F3N2O4 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-(2,3-dihydroxypropoxy)-3,4-difluoro-2-(2-fluoro-4-methylanilino)benzamide;ethane |
| SMILES | CC.Cc1ccc(Nc2c(C(=O)NOCC(O)CO)ccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C17H17F3N2O4.C2H6/c1-9-2-5-14(13(19)6-9)21-16-11(3-4-12(18)15(16)20)17(25)22-26-8-10(24)7-23;1-2/h2-6,10,21,23-24H,7-8H2,1H3,(H,22,25);1-2H3 |
| InChIKey | KXBDJGFNKUFFOI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|