C22H30FN3O5 — CID 143806427
N-(2,3-dihydroxypropoxy)-7-(2-fluoro-4-methylanilino)-6-methyl-5-oxo-2,3-dihydro-1H-indolizine-8-carboxamide;ethane (PubChem CID 143806427) has the molecular formula C22H30FN3O5 and a molecular weight of 435.50 g/mol. Its IUPAC name is N-(2,3-dihydroxypropoxy)-7-(2-fluoro-4-methylanilino)-6-methyl-5-oxo-2,3-dihydro-1H-indolizine-8-carboxamide;ethane.
| Compound Name | N-(2,3-dihydroxypropoxy)-7-(2-fluoro-4-methylanilino)-6-methyl-5-oxo-2,3-dihydro-1H-indolizine-8-carboxamide;ethane |
|---|---|
| PubChem CID | 143806427 |
| Molecular Formula | C22H30FN3O5 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | N-(2,3-dihydroxypropoxy)-7-(2-fluoro-4-methylanilino)-6-methyl-5-oxo-2,3-dihydro-1H-indolizine-8-carboxamide;ethane |
| SMILES | CC.Cc1ccc(Nc2c(C(=O)NOCC(O)CO)c3n(c(=O)c2C)CCC3)c(F)c1 |
| InChI | InChI=1S/C20H24FN3O5.C2H6/c1-11-5-6-15(14(21)8-11)22-18-12(2)20(28)24-7-3-4-16(24)17(18)19(27)23-29-10-13(26)9-25;1-2/h5-6,8,13,22,25-26H,3-4,7,9-10H2,1-2H3,(H,23,27);1-2H3 |
| InChIKey | QJZREEYYBZVONR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|