C18H18BFN2O3 — CID 89023824
CID 89023824 (PubChem CID 89023824) has the molecular formula C18H18BFN2O3 and a molecular weight of 340.16 g/mol.
| Compound Name | CID 89023824 |
|---|---|
| PubChem CID | 89023824 |
| Molecular Formula | C18H18BFN2O3 |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(Nc2c(C(=O)OCC)c3n(c(=O)c2C)CCC3)c(F)c1 |
| InChI | InChI=1S/C18H18BFN2O3/c1-3-25-18(24)15-14-5-4-8-22(14)17(23)10(2)16(15)21-13-7-6-11(19)9-12(13)20/h6-7,9,21H,3-5,8H2,1-2H3 |
| InChIKey | OSTOLOZQFPBVNI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|