C18H18F2IN3O4 — CID 42606321
6-fluoro-7-(2-fluoro-4-iodoanilino)-N-(3-hydroxypropoxy)-5-oxo-2,3-dihydro-1H-indolizine-8-carboxamide (PubChem CID 42606321) has the molecular formula C18H18F2IN3O4 and a molecular weight of 505.26 g/mol. Its IUPAC name is 6-fluoro-7-(2-fluoro-4-iodoanilino)-N-(3-hydroxypropoxy)-5-oxo-2,3-dihydro-1H-indolizine-8-carboxamide.
| Compound Name | 6-fluoro-7-(2-fluoro-4-iodoanilino)-N-(3-hydroxypropoxy)-5-oxo-2,3-dihydro-1H-indolizine-8-carboxamide |
|---|---|
| PubChem CID | 42606321 |
| Molecular Formula | C18H18F2IN3O4 |
| Molecular Weight | 505.26 g/mol |
| Exact Mass | 505.03 |
| IUPAC Name | 6-fluoro-7-(2-fluoro-4-iodoanilino)-N-(3-hydroxypropoxy)-5-oxo-2,3-dihydro-1H-indolizine-8-carboxamide |
| SMILES | O=C(NOCCCO)c1c(Nc2ccc(I)cc2F)c(F)c(=O)n2c1CCC2 |
| InChI | InChI=1S/C18H18F2IN3O4/c19-11-9-10(21)4-5-12(11)22-16-14(17(26)23-28-8-2-7-25)13-3-1-6-24(13)18(27)15(16)20/h4-5,9,22,25H,1-3,6-8H2,(H,23,26) |
| InChIKey | RBYIURLPUPZLAC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|