C21H27ClFN3O4 — CID 143806439
6-chloro-7-(2-fluoro-4-methylanilino)-N-(3-hydroxypropoxy)-5-oxo-2,3-dihydro-1H-indolizine-8-carboxamide;ethane (PubChem CID 143806439) has the molecular formula C21H27ClFN3O4 and a molecular weight of 439.92 g/mol. Its IUPAC name is 6-chloro-7-(2-fluoro-4-methylanilino)-N-(3-hydroxypropoxy)-5-oxo-2,3-dihydro-1H-indolizine-8-carboxamide;ethane.
| Compound Name | 6-chloro-7-(2-fluoro-4-methylanilino)-N-(3-hydroxypropoxy)-5-oxo-2,3-dihydro-1H-indolizine-8-carboxamide;ethane |
|---|---|
| PubChem CID | 143806439 |
| Molecular Formula | C21H27ClFN3O4 |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 6-chloro-7-(2-fluoro-4-methylanilino)-N-(3-hydroxypropoxy)-5-oxo-2,3-dihydro-1H-indolizine-8-carboxamide;ethane |
| SMILES | CC.Cc1ccc(Nc2c(C(=O)NOCCCO)c3n(c(=O)c2Cl)CCC3)c(F)c1 |
| InChI | InChI=1S/C19H21ClFN3O4.C2H6/c1-11-5-6-13(12(21)10-11)22-17-15(18(26)23-28-9-3-8-25)14-4-2-7-24(14)19(27)16(17)20;1-2/h5-6,10,22,25H,2-4,7-9H2,1H3,(H,23,26);1-2H3 |
| InChIKey | BUJQYORTSLICHU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|