C17H21FN4O4 — CID 143439029
4-(2-fluoro-4-methylanilino)-N-(3-hydroxypropoxy)-1,5-dimethyl-6-oxopyridazine-3-carboxamide (PubChem CID 143439029) has the molecular formula C17H21FN4O4 and a molecular weight of 364.38 g/mol. Its IUPAC name is 4-(2-fluoro-4-methylanilino)-N-(3-hydroxypropoxy)-1,5-dimethyl-6-oxopyridazine-3-carboxamide.
| Compound Name | 4-(2-fluoro-4-methylanilino)-N-(3-hydroxypropoxy)-1,5-dimethyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 143439029 |
| Molecular Formula | C17H21FN4O4 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4-(2-fluoro-4-methylanilino)-N-(3-hydroxypropoxy)-1,5-dimethyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cc1ccc(Nc2c(C(=O)NOCCCO)nn(C)c(=O)c2C)c(F)c1 |
| InChI | InChI=1S/C17H21FN4O4/c1-10-5-6-13(12(18)9-10)19-14-11(2)17(25)22(3)20-15(14)16(24)21-26-8-4-7-23/h5-6,9,19,23H,4,7-8H2,1-3H3,(H,21,24) |
| InChIKey | YZDXSQXPWFXUSI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|