C15H16FIN4O3 — CID 16666565
4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethyl)-1,5-dimethyl-6-oxopyridazine-3-carboxamide (PubChem CID 16666565) has the molecular formula C15H16FIN4O3 and a molecular weight of 446.22 g/mol. Its IUPAC name is 4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethyl)-1,5-dimethyl-6-oxopyridazine-3-carboxamide.
| Compound Name | 4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethyl)-1,5-dimethyl-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 16666565 |
| Molecular Formula | C15H16FIN4O3 |
| Molecular Weight | 446.22 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 4-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethyl)-1,5-dimethyl-6-oxopyridazine-3-carboxamide |
| SMILES | Cc1c(Nc2ccc(I)cc2F)c(C(=O)NCCO)nn(C)c1=O |
| InChI | InChI=1S/C15H16FIN4O3/c1-8-12(19-11-4-3-9(17)7-10(11)16)13(14(23)18-5-6-22)20-21(2)15(8)24/h3-4,7,19,22H,5-6H2,1-2H3,(H,18,23) |
| InChIKey | MTOLGHULWFVJRL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|