C13H9F2IN2O2 — CID 150172306
3-fluoro-2-(2-fluoro-4-iodoanilino)-N-hydroxybenzamide (PubChem CID 150172306) has the molecular formula C13H9F2IN2O2 and a molecular weight of 390.13 g/mol. Its IUPAC name is 3-fluoro-2-(2-fluoro-4-iodoanilino)-N-hydroxybenzamide.
| Compound Name | 3-fluoro-2-(2-fluoro-4-iodoanilino)-N-hydroxybenzamide |
|---|---|
| PubChem CID | 150172306 |
| Molecular Formula | C13H9F2IN2O2 |
| Molecular Weight | 390.13 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | 3-fluoro-2-(2-fluoro-4-iodoanilino)-N-hydroxybenzamide |
| SMILES | O=C(NO)c1cccc(F)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C13H9F2IN2O2/c14-9-3-1-2-8(13(19)18-20)12(9)17-11-5-4-7(16)6-10(11)15/h1-6,17,20H,(H,18,19) |
| InChIKey | FJRMGIWCAFXCMD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.13 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|